C13H15NO2 — CID 103454747
1-quinolin-6-ylbutane-1,2-diol (PubChem CID 103454747) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-quinolin-6-ylbutane-1,2-diol.
| Compound Name | 1-quinolin-6-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 103454747 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-quinolin-6-ylbutane-1,2-diol |
| SMILES | CCC(O)C(O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H15NO2/c1-2-12(15)13(16)10-5-6-11-9(8-10)4-3-7-14-11/h3-8,12-13,15-16H,2H2,1H3 |
| InChIKey | MSEAIYJQGUMUDK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |