C13H13NO4 — CID 171864271
methyl 2,3-dihydroxy-3-quinolin-6-ylpropanoate (PubChem CID 171864271) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-quinolin-6-ylpropanoate.
| Compound Name | methyl 2,3-dihydroxy-3-quinolin-6-ylpropanoate |
|---|---|
| PubChem CID | 171864271 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl 2,3-dihydroxy-3-quinolin-6-ylpropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H13NO4/c1-18-13(17)12(16)11(15)9-4-5-10-8(7-9)3-2-6-14-10/h2-7,11-12,15-16H,1H3 |
| InChIKey | AEDVIOWPIBHXJN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |