C20H20N2O4 — CID 171856144
benzyl N-(2,3-dihydroxy-3-quinolin-7-ylpropyl)carbamate (PubChem CID 171856144) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is benzyl N-(2,3-dihydroxy-3-quinolin-7-ylpropyl)carbamate.
| Compound Name | benzyl N-(2,3-dihydroxy-3-quinolin-7-ylpropyl)carbamate |
|---|---|
| PubChem CID | 171856144 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | benzyl N-(2,3-dihydroxy-3-quinolin-7-ylpropyl)carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc2cccnc2c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c23-18(12-22-20(25)26-13-14-5-2-1-3-6-14)19(24)16-9-8-15-7-4-10-21-17(15)11-16/h1-11,18-19,23-24H,12-13H2,(H,22,25) |
| InChIKey | ZPPNLDMWBZNUOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |