C18H19N3O4S — CID 171856122
benzyl N-[3-(2-amino-1,3-benzothiazol-6-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856122) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is benzyl N-[3-(2-amino-1,3-benzothiazol-6-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2-amino-1,3-benzothiazol-6-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856122 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | benzyl N-[3-(2-amino-1,3-benzothiazol-6-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Nc1nc2ccc(C(O)C(O)CNC(=O)OCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C18H19N3O4S/c19-17-21-13-7-6-12(8-15(13)26-17)16(23)14(22)9-20-18(24)25-10-11-4-2-1-3-5-11/h1-8,14,16,22-23H,9-10H2,(H2,19,21)(H,20,24) |
| InChIKey | RFQRWFSYWXTYRN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |