C19H21N3O4S — CID 171888625
benzyl N-[4-(2-amino-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888625) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is benzyl N-[4-(2-amino-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2-amino-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888625 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | benzyl N-[4-(2-amino-1,3-benzothiazol-6-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1nc2ccc(C(O)C(O)CCNC(=O)OCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C19H21N3O4S/c20-18-22-14-7-6-13(10-16(14)27-18)17(24)15(23)8-9-21-19(25)26-11-12-4-2-1-3-5-12/h1-7,10,15,17,23-24H,8-9,11H2,(H2,20,22)(H,21,25) |
| InChIKey | DYWYBUYPZCJSLP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |