C15H16ClNO3S — CID 171876651
S-[4-(4-chloroquinolin-6-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876651) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is S-[4-(4-chloroquinolin-6-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(4-chloroquinolin-6-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876651 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | S-[4-(4-chloroquinolin-6-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc2nccc(Cl)c2c1 |
| InChI | InChI=1S/C15H16ClNO3S/c1-9(18)21-7-5-14(19)15(20)10-2-3-13-11(8-10)12(16)4-6-17-13/h2-4,6,8,14-15,19-20H,5,7H2,1H3 |
| InChIKey | IZFZVYYVUJBXNI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|