C13H16N2O4S — CID 171876094
S-[3,4-dihydroxy-4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butyl] ethanethioate (PubChem CID 171876094) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butyl] ethanethioate |
|---|---|
| PubChem CID | 171876094 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | S-[3,4-dihydroxy-4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-7(16)20-5-4-11(17)12(18)8-2-3-9-10(6-8)15-13(19)14-9/h2-3,6,11-12,17-18H,4-5H2,1H3,(H2,14,15,19) |
| InChIKey | PZGMBZWONBPCMA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|