C14H20O3S2 — CID 171875713
S-[4-(3-ethylsulfanylphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875713) has the molecular formula C14H20O3S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is S-[4-(3-ethylsulfanylphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(3-ethylsulfanylphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875713 |
| Molecular Formula | C14H20O3S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | S-[4-(3-ethylsulfanylphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CCSc1cccc(C(O)C(O)CCSC(C)=O)c1 |
| InChI | InChI=1S/C14H20O3S2/c1-3-18-12-6-4-5-11(9-12)14(17)13(16)7-8-19-10(2)15/h4-6,9,13-14,16-17H,3,7-8H2,1-2H3 |
| InChIKey | CFYZFXWPSPYNFS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|