C11H14ClNO3S — CID 171875352
S-[4-(6-chloro-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875352) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is S-[4-(6-chloro-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(6-chloro-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875352 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | S-[4-(6-chloro-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C11H14ClNO3S/c1-7(14)17-6-5-9(15)11(16)8-3-2-4-10(12)13-8/h2-4,9,11,15-16H,5-6H2,1H3 |
| InChIKey | PQJLLMGECKAEKK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|