C12H16O5S — CID 171875474
S-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875474) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is S-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875474 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | S-[4-(2,6-dihydroxyphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1c(O)cccc1O |
| InChI | InChI=1S/C12H16O5S/c1-7(13)18-6-5-10(16)12(17)11-8(14)3-2-4-9(11)15/h2-4,10,12,14-17H,5-6H2,1H3 |
| InChIKey | ODQPCQHJMVTGMZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|