C12H13Br2FO3S — CID 171877001
S-[4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171877001) has the molecular formula C12H13Br2FO3S and a molecular weight of 416.11 g/mol. Its IUPAC name is S-[4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171877001 |
| Molecular Formula | C12H13Br2FO3S |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.89 |
| IUPAC Name | S-[4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C12H13Br2FO3S/c1-6(16)19-3-2-10(17)12(18)11-8(13)4-7(15)5-9(11)14/h4-5,10,12,17-18H,2-3H2,1H3 |
| InChIKey | JSGUVRNAVMVVPA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|