C15H22O6S — CID 171876774
S-[3,4-dihydroxy-4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]butyl] ethanethioate (PubChem CID 171876774) has the molecular formula C15H22O6S and a molecular weight of 330.40 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]butyl] ethanethioate |
|---|---|
| PubChem CID | 171876774 |
| Molecular Formula | C15H22O6S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | S-[3,4-dihydroxy-4-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]butyl] ethanethioate |
| SMILES | COc1cc(CO)cc(OC)c1C(O)C(O)CCSC(C)=O |
| InChI | InChI=1S/C15H22O6S/c1-9(17)22-5-4-11(18)15(19)14-12(20-2)6-10(8-16)7-13(14)21-3/h6-7,11,15-16,18-19H,4-5,8H2,1-3H3 |
| InChIKey | SBUAITIPUTZDIB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|