C13H20O5S — CID 171874982
1-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-4-sulfanylbutane-1,2-diol (PubChem CID 171874982) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874982 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-4-sulfanylbutane-1,2-diol |
| SMILES | COc1cc(CO)cc(OC)c1C(O)C(O)CCS |
| InChI | InChI=1S/C13H20O5S/c1-17-10-5-8(7-14)6-11(18-2)12(10)13(16)9(15)3-4-19/h5-6,9,13-16,19H,3-4,7H2,1-2H3 |
| InChIKey | AGVHEWXFEKSURH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|