C13H18O5S — CID 171874983
4-(1,2-dihydroxy-4-sulfanylbutyl)-2,5-dimethoxybenzaldehyde (PubChem CID 171874983) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-(1,2-dihydroxy-4-sulfanylbutyl)-2,5-dimethoxybenzaldehyde.
| Compound Name | 4-(1,2-dihydroxy-4-sulfanylbutyl)-2,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 171874983 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-(1,2-dihydroxy-4-sulfanylbutyl)-2,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C(O)C(O)CCS)c(OC)cc1C=O |
| InChI | InChI=1S/C13H18O5S/c1-17-11-6-9(13(16)10(15)3-4-19)12(18-2)5-8(11)7-14/h5-7,10,13,15-16,19H,3-4H2,1-2H3 |
| InChIKey | LNTCKIMEEOHZOO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|