C11H14O4S — CID 170820165
2-(1,2-dihydroxy-3-sulfanylpropyl)-4-methoxybenzaldehyde (PubChem CID 170820165) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-3-sulfanylpropyl)-4-methoxybenzaldehyde.
| Compound Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 170820165 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)c(C(O)C(O)CS)c1 |
| InChI | InChI=1S/C11H14O4S/c1-15-8-3-2-7(5-12)9(4-8)11(14)10(13)6-16/h2-5,10-11,13-14,16H,6H2,1H3 |
| InChIKey | LMDCUZLCQRMYCO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|