C11H12O5S — CID 170820622
6-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 170820622) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is 6-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 170820622 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 6-(1,2-dihydroxy-3-sulfanylpropyl)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1C(O)C(O)CS)OCO2 |
| InChI | InChI=1S/C11H12O5S/c12-3-6-1-9-10(16-5-15-9)2-7(6)11(14)8(13)4-17/h1-3,8,11,13-14,17H,4-5H2 |
| InChIKey | NOGLLQXYUWQOSB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|