C13H15NO6 — CID 170830804
N-[3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830804) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is N-[3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830804 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C13H15NO6/c1-7(16)14-4-10(17)13(18)9-3-12-11(19-6-20-12)2-8(9)5-15/h2-3,5,10,13,17-18H,4,6H2,1H3,(H,14,16) |
| InChIKey | SLYUPHICRYABMG-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|