C11H10O7 — CID 170824702
3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoic acid (PubChem CID 170824702) has the molecular formula C11H10O7 and a molecular weight of 254.19 g/mol. Its IUPAC name is 3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170824702 |
| Molecular Formula | C11H10O7 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-(6-formyl-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoic acid |
| SMILES | O=Cc1cc2c(cc1C(O)C(O)C(=O)O)OCO2 |
| InChI | InChI=1S/C11H10O7/c12-3-5-1-7-8(18-4-17-7)2-6(5)9(13)10(14)11(15)16/h1-3,9-10,13-14H,4H2,(H,15,16) |
| InChIKey | WFPXRDNCZIRQRH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|