C8H5FO3 — CID 14384443
6-fluoro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 14384443) has the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. Its IUPAC name is 6-fluoro-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-fluoro-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 14384443 |
| Molecular Formula | C8H5FO3 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 6-fluoro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1F)OCO2 |
| InChI | InChI=1S/C8H5FO3/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-3H,4H2 |
| InChIKey | LOIJRUNLOIAQDI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|