C14H9FO4 — CID 114067205
2-(1,3-benzodioxol-5-yloxy)-3-fluorobenzaldehyde (PubChem CID 114067205) has the molecular formula C14H9FO4 and a molecular weight of 260.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-3-fluorobenzaldehyde.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 114067205 |
| Molecular Formula | C14H9FO4 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-3-fluorobenzaldehyde |
| SMILES | O=Cc1cccc(F)c1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H9FO4/c15-11-3-1-2-9(7-16)14(11)19-10-4-5-12-13(6-10)18-8-17-12/h1-7H,8H2 |
| InChIKey | BUQDWPXFICKKKP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|