C15H14FNO3 — CID 43188982
1-[2-(1,3-benzodioxol-5-yloxy)-6-fluorophenyl]ethanamine (PubChem CID 43188982) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)-6-fluorophenyl]ethanamine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)-6-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 43188982 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)-6-fluorophenyl]ethanamine |
| SMILES | CC(N)c1c(F)cccc1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14FNO3/c1-9(17)15-11(16)3-2-4-13(15)20-10-5-6-12-14(7-10)19-8-18-12/h2-7,9H,8,17H2,1H3 |
| InChIKey | OQHBONDDTJSWQJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |