C14H12FNO3 — CID 43314084
[2-(1,3-benzodioxol-5-yloxy)-5-fluorophenyl]methanamine (PubChem CID 43314084) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yloxy)-5-fluorophenyl]methanamine.
| Compound Name | [2-(1,3-benzodioxol-5-yloxy)-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 43314084 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yloxy)-5-fluorophenyl]methanamine |
| SMILES | NCc1cc(F)ccc1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12FNO3/c15-10-1-3-12(9(5-10)7-16)19-11-2-4-13-14(6-11)18-8-17-13/h1-6H,7-8,16H2 |
| InChIKey | YIGYDQGRECBVHM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |