C15H15NO5 — CID 83005076
2-(1,3-benzodioxol-5-yloxy)-4,5-dimethoxyaniline (PubChem CID 83005076) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-4,5-dimethoxyaniline.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 83005076 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(Oc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C15H15NO5/c1-17-13-6-10(16)12(7-14(13)18-2)21-9-3-4-11-15(5-9)20-8-19-11/h3-7H,8,16H2,1-2H3 |
| InChIKey | IGGZVORAEJIRSJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|