C16H12N2O3 — CID 103139764
8-(1,3-benzodioxol-5-yloxy)isoquinolin-5-amine (PubChem CID 103139764) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-yloxy)isoquinolin-5-amine.
| Compound Name | 8-(1,3-benzodioxol-5-yloxy)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103139764 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 8-(1,3-benzodioxol-5-yloxy)isoquinolin-5-amine |
| SMILES | Nc1ccc(Oc2ccc3c(c2)OCO3)c2cnccc12 |
| InChI | InChI=1S/C16H12N2O3/c17-13-2-4-14(12-8-18-6-5-11(12)13)21-10-1-3-15-16(7-10)20-9-19-15/h1-8H,9,17H2 |
| InChIKey | AJDWQOAKUHMAJB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|