About isoquinoline-5,8-diamine;hydrochloride
isoquinoline-5,8-diamine;hydrochloride (PubChem CID 75525603) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is isoquinoline-5,8-diamine;hydrochloride.
Molecular Properties
| Compound Name | isoquinoline-5,8-diamine;hydrochloride |
| PubChem CID | 75525603 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | isoquinoline-5,8-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(N)c2cnccc12 |
| InChI | InChI=1S/C9H9N3.ClH/c10-8-1-2-9(11)7-5-12-4-3-6(7)8;/h1-5H,10-11H2;1H |
| InChIKey | ZUCDQUDHIYZION-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze isoquinoline-5,8-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline-5,8-diamine;hydrochloride?
The IUPAC name of isoquinoline-5,8-diamine;hydrochloride (CID 75525603) is isoquinoline-5,8-diamine;hydrochloride.
What is the SMILES notation for isoquinoline-5,8-diamine;hydrochloride?
The canonical SMILES for isoquinoline-5,8-diamine;hydrochloride is Cl.Nc1ccc(N)c2cnccc12.
What is the InChIKey of isoquinoline-5,8-diamine;hydrochloride?
The InChIKey is ZUCDQUDHIYZION-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.ClH/c10-8-1-2-9(11)7-5-12-4-3-6(7)8;/h1-5H,10-11H2;1H.
What are the key properties of isoquinoline-5,8-diamine;hydrochloride?
isoquinoline-5,8-diamine;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of 1.82, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline-5,8-diamine;hydrochloride is sourced from PubChem (CID 75525603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).