C12H10N4 — CID 118108253
2,9-phenanthroline-5,6-diamine (PubChem CID 118108253) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2,9-phenanthroline-5,6-diamine.
| Compound Name | 2,9-phenanthroline-5,6-diamine |
|---|---|
| PubChem CID | 118108253 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2,9-phenanthroline-5,6-diamine |
| SMILES | Nc1c(N)c2ccncc2c2cnccc12 |
| InChI | InChI=1S/C12H10N4/c13-11-7-1-3-15-5-9(7)10-6-16-4-2-8(10)12(11)14/h1-6H,13-14H2 |
| InChIKey | JKDLWNYNEIJUAV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|