About 8-aminoisoquinolin-7-ol;hydrochloride
8-aminoisoquinolin-7-ol;hydrochloride (PubChem CID 67670050) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 8-aminoisoquinolin-7-ol;hydrochloride.
Molecular Properties
| Compound Name | 8-aminoisoquinolin-7-ol;hydrochloride |
| PubChem CID | 67670050 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 8-aminoisoquinolin-7-ol;hydrochloride |
| SMILES | Cl.Nc1c(O)ccc2ccncc12 |
| InChI | InChI=1S/C9H8N2O.ClH/c10-9-7-5-11-4-3-6(7)1-2-8(9)12;/h1-5,12H,10H2;1H |
| InChIKey | ZHXPRMOVCNHUAM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 8-aminoisoquinolin-7-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminoisoquinolin-7-ol;hydrochloride?
The IUPAC name of 8-aminoisoquinolin-7-ol;hydrochloride (CID 67670050) is 8-aminoisoquinolin-7-ol;hydrochloride.
What is the SMILES notation for 8-aminoisoquinolin-7-ol;hydrochloride?
The canonical SMILES for 8-aminoisoquinolin-7-ol;hydrochloride is Cl.Nc1c(O)ccc2ccncc12.
What is the InChIKey of 8-aminoisoquinolin-7-ol;hydrochloride?
The InChIKey is ZHXPRMOVCNHUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.ClH/c10-9-7-5-11-4-3-6(7)1-2-8(9)12;/h1-5,12H,10H2;1H.
What are the key properties of 8-aminoisoquinolin-7-ol;hydrochloride?
8-aminoisoquinolin-7-ol;hydrochloride has a molecular weight of 196.64 g/mol, XLogP of 1.94, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminoisoquinolin-7-ol;hydrochloride is sourced from PubChem (CID 67670050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).