C8H8N2O — CID 58826779
2-methylfuro[2,3-c]pyridin-3-amine (PubChem CID 58826779) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-methylfuro[2,3-c]pyridin-3-amine.
| Compound Name | 2-methylfuro[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 58826779 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-methylfuro[2,3-c]pyridin-3-amine |
| SMILES | Cc1oc2cnccc2c1N |
| InChI | InChI=1S/C8H8N2O/c1-5-8(9)6-2-3-10-4-7(6)11-5/h2-4H,9H2,1H3 |
| InChIKey | ZAKACJMAPVXGIC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |