C7H7N3O — CID 90474365
furo[3,4-c]pyridine-1,3-diamine (PubChem CID 90474365) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is furo[3,4-c]pyridine-1,3-diamine.
| Compound Name | furo[3,4-c]pyridine-1,3-diamine |
|---|---|
| PubChem CID | 90474365 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | furo[3,4-c]pyridine-1,3-diamine |
| SMILES | Nc1oc(N)c2cnccc12 |
| InChI | InChI=1S/C7H7N3O/c8-6-4-1-2-10-3-5(4)7(9)11-6/h1-3H,8-9H2 |
| InChIKey | SFRFIECPAQDLIA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |