C11H14N4 — CID 103138118
8-N-(2-aminoethyl)isoquinoline-5,8-diamine (PubChem CID 103138118) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 8-N-(2-aminoethyl)isoquinoline-5,8-diamine.
| Compound Name | 8-N-(2-aminoethyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103138118 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 8-N-(2-aminoethyl)isoquinoline-5,8-diamine |
| SMILES | NCCNc1ccc(N)c2ccncc12 |
| InChI | InChI=1S/C11H14N4/c12-4-6-15-11-2-1-10(13)8-3-5-14-7-9(8)11/h1-3,5,7,15H,4,6,12-13H2 |
| InChIKey | WPKWCJBAVRUPNP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|