C13H17N3 — CID 43448702
5-N-butylisoquinoline-5,8-diamine (PubChem CID 43448702) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-N-butylisoquinoline-5,8-diamine.
| Compound Name | 5-N-butylisoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 43448702 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 5-N-butylisoquinoline-5,8-diamine |
| SMILES | CCCCNc1ccc(N)c2cnccc12 |
| InChI | InChI=1S/C13H17N3/c1-2-3-7-16-13-5-4-12(14)11-9-15-8-6-10(11)13/h4-6,8-9,16H,2-3,7,14H2,1H3 |
| InChIKey | JPYLZPLESALHJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|