C14H17N3 — CID 114155060
5-N-(3-methylbut-2-enyl)isoquinoline-5,8-diamine (PubChem CID 114155060) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-N-(3-methylbut-2-enyl)isoquinoline-5,8-diamine.
| Compound Name | 5-N-(3-methylbut-2-enyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 114155060 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-N-(3-methylbut-2-enyl)isoquinoline-5,8-diamine |
| SMILES | CC(C)=CCNc1ccc(N)c2cnccc12 |
| InChI | InChI=1S/C14H17N3/c1-10(2)5-8-17-14-4-3-13(15)12-9-16-7-6-11(12)14/h3-7,9,17H,8,15H2,1-2H3 |
| InChIKey | HOZZWGXNMACXSS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|