C12H15N3S — CID 103138347
8-N-(2-methylsulfanylethyl)isoquinoline-5,8-diamine (PubChem CID 103138347) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 8-N-(2-methylsulfanylethyl)isoquinoline-5,8-diamine.
| Compound Name | 8-N-(2-methylsulfanylethyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103138347 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 8-N-(2-methylsulfanylethyl)isoquinoline-5,8-diamine |
| SMILES | CSCCNc1ccc(N)c2ccncc12 |
| InChI | InChI=1S/C12H15N3S/c1-16-7-6-15-12-3-2-11(13)9-4-5-14-8-10(9)12/h2-5,8,15H,6-7,13H2,1H3 |
| InChIKey | TVHCDEVSZHJWPV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|