C18H27N3 — CID 103138755
8-N-(2,2-dimethylheptyl)isoquinoline-5,8-diamine (PubChem CID 103138755) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 8-N-(2,2-dimethylheptyl)isoquinoline-5,8-diamine.
| Compound Name | 8-N-(2,2-dimethylheptyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103138755 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 8-N-(2,2-dimethylheptyl)isoquinoline-5,8-diamine |
| SMILES | CCCCCC(C)(C)CNc1ccc(N)c2ccncc12 |
| InChI | InChI=1S/C18H27N3/c1-4-5-6-10-18(2,3)13-21-17-8-7-16(19)14-9-11-20-12-15(14)17/h7-9,11-12,21H,4-6,10,13,19H2,1-3H3 |
| InChIKey | AXBVGAZCVBJMQR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|