C12H13F2N3O — CID 106167568
3-[(5-aminoisoquinolin-8-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 106167568) has the molecular formula C12H13F2N3O and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-[(5-aminoisoquinolin-8-yl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(5-aminoisoquinolin-8-yl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 106167568 |
| Molecular Formula | C12H13F2N3O |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[(5-aminoisoquinolin-8-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | Nc1ccc(NCC(F)(F)CO)c2cnccc12 |
| InChI | InChI=1S/C12H13F2N3O/c13-12(14,7-18)6-17-11-2-1-10(15)8-3-4-16-5-9(8)11/h1-5,17-18H,6-7,15H2 |
| InChIKey | PNUNGLQZLGHEPI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|