C16H23N3O — CID 106141358
5-[(5-aminoisoquinolin-6-yl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 106141358) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-[(5-aminoisoquinolin-6-yl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(5-aminoisoquinolin-6-yl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106141358 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 5-[(5-aminoisoquinolin-6-yl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1ccc2cnccc2c1N |
| InChI | InChI=1S/C16H23N3O/c1-16(2,7-3-9-20)11-19-14-5-4-12-10-18-8-6-13(12)15(14)17/h4-6,8,10,19-20H,3,7,9,11,17H2,1-2H3 |
| InChIKey | GCGUJHJJDZOAOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|