C14H19N3O — CID 106947522
6-N-(3-ethoxypropyl)isoquinoline-5,6-diamine (PubChem CID 106947522) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-N-(3-ethoxypropyl)isoquinoline-5,6-diamine.
| Compound Name | 6-N-(3-ethoxypropyl)isoquinoline-5,6-diamine |
|---|---|
| PubChem CID | 106947522 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 6-N-(3-ethoxypropyl)isoquinoline-5,6-diamine |
| SMILES | CCOCCCNc1ccc2cnccc2c1N |
| InChI | InChI=1S/C14H19N3O/c1-2-18-9-3-7-17-13-5-4-11-10-16-8-6-12(11)14(13)15/h4-6,8,10,17H,2-3,7,9,15H2,1H3 |
| InChIKey | ZHYUYYCXUWWFQS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|