C15H20N4O — CID 106948362
2-[(5-aminoisoquinolin-6-yl)amino]-N,N-diethylacetamide (PubChem CID 106948362) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[(5-aminoisoquinolin-6-yl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[(5-aminoisoquinolin-6-yl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 106948362 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[(5-aminoisoquinolin-6-yl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNc1ccc2cnccc2c1N |
| InChI | InChI=1S/C15H20N4O/c1-3-19(4-2)14(20)10-18-13-6-5-11-9-17-8-7-12(11)15(13)16/h5-9,18H,3-4,10,16H2,1-2H3 |
| InChIKey | CDJJHXGIDMAAIH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|