C11H9F3N2O — CID 103139582
8-(2,2,2-trifluoroethoxy)isoquinolin-5-amine (PubChem CID 103139582) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethoxy)isoquinolin-5-amine.
| Compound Name | 8-(2,2,2-trifluoroethoxy)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103139582 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 8-(2,2,2-trifluoroethoxy)isoquinolin-5-amine |
| SMILES | Nc1ccc(OCC(F)(F)F)c2cnccc12 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)6-17-10-2-1-9(15)7-3-4-16-5-8(7)10/h1-5H,6,15H2 |
| InChIKey | LHVIQWNVQDCNHV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|