C13H13F3N2O — CID 103140102
8-(4,4,4-trifluorobutoxy)isoquinolin-5-amine (PubChem CID 103140102) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 8-(4,4,4-trifluorobutoxy)isoquinolin-5-amine.
| Compound Name | 8-(4,4,4-trifluorobutoxy)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103140102 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 8-(4,4,4-trifluorobutoxy)isoquinolin-5-amine |
| SMILES | Nc1ccc(OCCCC(F)(F)F)c2cnccc12 |
| InChI | InChI=1S/C13H13F3N2O/c14-13(15,16)5-1-7-19-12-3-2-11(17)9-4-6-18-8-10(9)12/h2-4,6,8H,1,5,7,17H2 |
| InChIKey | CMHONLCFBBHRDM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|