C11H10F2N2O — CID 103140098
8-(2,2-difluoroethoxy)isoquinolin-5-amine (PubChem CID 103140098) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is 8-(2,2-difluoroethoxy)isoquinolin-5-amine.
| Compound Name | 8-(2,2-difluoroethoxy)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103140098 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 8-(2,2-difluoroethoxy)isoquinolin-5-amine |
| SMILES | Nc1ccc(OCC(F)F)c2cnccc12 |
| InChI | InChI=1S/C11H10F2N2O/c12-11(13)6-16-10-2-1-9(14)7-3-4-15-5-8(7)10/h1-5,11H,6,14H2 |
| InChIKey | BIZGKODNPZQWKJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|