C15H9Cl3N2O — CID 103139705
8-(2,4,5-trichlorophenoxy)isoquinolin-5-amine (PubChem CID 103139705) has the molecular formula C15H9Cl3N2O and a molecular weight of 339.61 g/mol. Its IUPAC name is 8-(2,4,5-trichlorophenoxy)isoquinolin-5-amine.
| Compound Name | 8-(2,4,5-trichlorophenoxy)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103139705 |
| Molecular Formula | C15H9Cl3N2O |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 8-(2,4,5-trichlorophenoxy)isoquinolin-5-amine |
| SMILES | Nc1ccc(Oc2cc(Cl)c(Cl)cc2Cl)c2cnccc12 |
| InChI | InChI=1S/C15H9Cl3N2O/c16-10-5-12(18)15(6-11(10)17)21-14-2-1-13(19)8-3-4-20-7-9(8)14/h1-7H,19H2 |
| InChIKey | QIAQZIZKNBULCF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|