C16H14ClN3O — CID 103136960
8-N-(3-chloro-4-methoxyphenyl)isoquinoline-5,8-diamine (PubChem CID 103136960) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is 8-N-(3-chloro-4-methoxyphenyl)isoquinoline-5,8-diamine.
| Compound Name | 8-N-(3-chloro-4-methoxyphenyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103136960 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 8-N-(3-chloro-4-methoxyphenyl)isoquinoline-5,8-diamine |
| SMILES | COc1ccc(Nc2ccc(N)c3ccncc23)cc1Cl |
| InChI | InChI=1S/C16H14ClN3O/c1-21-16-5-2-10(8-13(16)17)20-15-4-3-14(18)11-6-7-19-9-12(11)15/h2-9,20H,18H2,1H3 |
| InChIKey | OSYWQIKOTUHBPJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|