C13H12F3NO — CID 64552253
4-(3,3,3-trifluoropropoxy)naphthalen-1-amine (PubChem CID 64552253) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropoxy)naphthalen-1-amine.
| Compound Name | 4-(3,3,3-trifluoropropoxy)naphthalen-1-amine |
|---|---|
| PubChem CID | 64552253 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-(3,3,3-trifluoropropoxy)naphthalen-1-amine |
| SMILES | Nc1ccc(OCCC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)7-8-18-12-6-5-11(17)9-3-1-2-4-10(9)12/h1-6H,7-8,17H2 |
| InChIKey | ZDOXHOPRRIBFCC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|