C13H12N2O3 — CID 162632386
3-(6-methoxy-1,3-benzodioxol-5-yl)pyridin-4-amine (PubChem CID 162632386) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(6-methoxy-1,3-benzodioxol-5-yl)pyridin-4-amine.
| Compound Name | 3-(6-methoxy-1,3-benzodioxol-5-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 162632386 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-(6-methoxy-1,3-benzodioxol-5-yl)pyridin-4-amine |
| SMILES | COc1cc2c(cc1-c1cnccc1N)OCO2 |
| InChI | InChI=1S/C13H12N2O3/c1-16-11-5-13-12(17-7-18-13)4-8(11)9-6-15-3-2-10(9)14/h2-6H,7H2,1H3,(H2,14,15) |
| InChIKey | ZTVDBGBMRLONGX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |