C10H10N4O3 — CID 163306861
5-(6-methoxy-1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 163306861) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 5-(6-methoxy-1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(6-methoxy-1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 163306861 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-(6-methoxy-1,3-benzodioxol-5-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | COc1cc2c(cc1-c1nc(N)n[nH]1)OCO2 |
| InChI | InChI=1S/C10H10N4O3/c1-15-6-3-8-7(16-4-17-8)2-5(6)9-12-10(11)14-13-9/h2-3H,4H2,1H3,(H3,11,12,13,14) |
| InChIKey | JWUNAJVBEZYQCI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |