C9H11N5O — CID 115412365
5-(2-amino-4-methoxyphenyl)-1H-1,2,4-triazol-3-amine (PubChem CID 115412365) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-(2-amino-4-methoxyphenyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(2-amino-4-methoxyphenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115412365 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 5-(2-amino-4-methoxyphenyl)-1H-1,2,4-triazol-3-amine |
| SMILES | COc1ccc(-c2nc(N)n[nH]2)c(N)c1 |
| InChI | InChI=1S/C9H11N5O/c1-15-5-2-3-6(7(10)4-5)8-12-9(11)14-13-8/h2-4H,10H2,1H3,(H3,11,12,13,14) |
| InChIKey | DTGLQYGARQFLQI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|