C16H17N3O — CID 115411342
2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methoxyaniline (PubChem CID 115411342) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methoxyaniline.
| Compound Name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 115411342 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)c(-c2nc3cc(C)c(C)cc3[nH]2)c1 |
| InChI | InChI=1S/C16H17N3O/c1-9-6-14-15(7-10(9)2)19-16(18-14)12-8-11(20-3)4-5-13(12)17/h4-8H,17H2,1-3H3,(H,18,19) |
| InChIKey | XAQDRQYSFIXMBM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|