C16H15FN2 — CID 112688356
2-(4-fluoro-2-methylphenyl)-5,6-dimethyl-1H-benzimidazole (PubChem CID 112688356) has the molecular formula C16H15FN2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-5,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-5,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 112688356 |
| Molecular Formula | C16H15FN2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-5,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc2nc(-c3ccc(F)cc3C)[nH]c2cc1C |
| InChI | InChI=1S/C16H15FN2/c1-9-7-14-15(8-10(9)2)19-16(18-14)13-5-4-12(17)6-11(13)3/h4-8H,1-3H3,(H,18,19) |
| InChIKey | PGELXMNADBVPRE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |