C19H15ClN2 — CID 56737110
2-(5-chloronaphthalen-1-yl)-5,6-dimethyl-1H-benzimidazole (PubChem CID 56737110) has the molecular formula C19H15ClN2 and a molecular weight of 306.80 g/mol. Its IUPAC name is 2-(5-chloronaphthalen-1-yl)-5,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(5-chloronaphthalen-1-yl)-5,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 56737110 |
| Molecular Formula | C19H15ClN2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(5-chloronaphthalen-1-yl)-5,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc2nc(-c3cccc4c(Cl)cccc34)[nH]c2cc1C |
| InChI | InChI=1S/C19H15ClN2/c1-11-9-17-18(10-12(11)2)22-19(21-17)15-7-3-6-14-13(15)5-4-8-16(14)20/h3-10H,1-2H3,(H,21,22) |
| InChIKey | IOLVWHHAJZGARS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |